WAY-329745 structure
|
Common Name | WAY-329745 | ||
|---|---|---|---|---|
| CAS Number | 958587-50-3 | Molecular Weight | 376.43 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 676.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.2±31.5 °C | |
Use of WAY-329745antitubercular activity |
| Name | WAY-329745 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 676.9±55.0 °C at 760 mmHg |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.43 |
| Flash Point | 363.2±31.5 °C |
| Exact Mass | 373.146027 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | OFQPPFGRQJFVDB-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2nc3c(c2NC(=O)C2CCCCC2)CS(=O)C3)cc1 |
| Cyclohexanecarboxamide, N-[2,6-dihydro-2-(4-methoxyphenyl)-5-oxido-4H-thieno[3,4-c]pyrazol-3-yl]- |
| N-[2-(4-Methoxyphenyl)-5-oxido-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-yl]cyclohexanecarboxamide |