N,N-Diethanololeamide structure
|
Common Name | N,N-Diethanololeamide | ||
|---|---|---|---|---|
| CAS Number | 93-83-4 | Molecular Weight | 369.58200 | |
| Density | 0.96g/cm3 | Boiling Point | 150ºC | |
| Molecular Formula | C22H43NO3 | Melting Point | -18ºC | |
| MSDS | N/A | Flash Point | 94ºC | |
| Name | N,N-Diethanololeamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.96g/cm3 |
|---|---|
| Boiling Point | 150ºC |
| Melting Point | -18ºC |
| Molecular Formula | C22H43NO3 |
| Molecular Weight | 369.58200 |
| Flash Point | 94ºC |
| Exact Mass | 369.32400 |
| PSA | 60.77000 |
| LogP | 4.83710 |
| Index of Refraction | 1.488 |
| InChIKey | LPMBTLLQQJBUOO-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N(CCO)CCO |
CHEMICAL IDENTIFICATION
|
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924199090 |
|
~72%
N,N-Diethanolol... CAS#:93-83-4 |
| Literature: LIFEGROUP S.p.A. Patent: EP550006 A2, 1993 ; |
|
~23%
N,N-Diethanolol... CAS#:93-83-4 |
| Literature: Liu; Nag; Shaw Journal of agricultural and food chemistry, 2001 , vol. 49, # 12 p. 5761 - 5764 |
|
~%
N,N-Diethanolol... CAS#:93-83-4 |
| Literature: Physical Chemistry Chemical Physics, , vol. 13, # 29 p. 13370 - 13381 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (Z)-N,N-bis(2-hydroxyethyl)octadec-9-enamide |
| EINECS 202-281-7 |