2-[2-(2,2-dimethylpropanoyloxy)ethyl-[(E)-octadec-9-enoyl]amino]ethyl 2,2-dimethylpropanoate structure
|
Common Name | 2-[2-(2,2-dimethylpropanoyloxy)ethyl-[(E)-octadec-9-enoyl]amino]ethyl 2,2-dimethylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 63056-97-3 | Molecular Weight | 537.81500 | |
| Density | 0.957g/cm3 | Boiling Point | 599.8ºC at 760 mmHg | |
| Molecular Formula | C32H59NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.5ºC | |
| Name | 2-[2-(2,2-dimethylpropanoyloxy)ethyl-[(E)-octadec-9-enoyl]amino]ethyl 2,2-dimethylpropanoate |
|---|
| Density | 0.957g/cm3 |
|---|---|
| Boiling Point | 599.8ºC at 760 mmHg |
| Molecular Formula | C32H59NO5 |
| Molecular Weight | 537.81500 |
| Flash Point | 316.5ºC |
| Exact Mass | 537.43900 |
| PSA | 72.91000 |
| LogP | 8.03110 |
| Index of Refraction | 1.472 |
| InChIKey | FRHZNLWYULRFSO-FOCLMDBBSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N(CCOC(=O)C(C)(C)C)CCOC(=O)C(C)(C)C |
|
~%
2-[2-(2,2-dimet... CAS#:63056-97-3 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US4017522 A1, 1977 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |