5-[2-(TRIFLUOROMETHYL)PHENYL]-2-FUROIC
Modify Date: 2025-08-27 09:12:34
![5-[2-(TRIFLUOROMETHYL)PHENYL]-2-FUROIC Structure](https://image.chemsrc.com/caspic/475/92973-24-5.png)
5-[2-(TRIFLUOROMETHYL)PHENYL]-2-FUROIC structure
|
Common Name | 5-[2-(TRIFLUOROMETHYL)PHENYL]-2-FUROIC | ||
|---|---|---|---|---|
| CAS Number | 92973-24-5 | Molecular Weight | 256.17700 | |
| Density | 1.395g/cm3 | Boiling Point | 372.9ºC at 760 mmHg | |
| Molecular Formula | C12H7F3O3 | Melting Point | 163-167ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 179.3ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 5-[2-(trifluoromethyl)phenyl]furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.395g/cm3 |
|---|---|
| Boiling Point | 372.9ºC at 760 mmHg |
| Melting Point | 163-167ºC(lit.) |
| Molecular Formula | C12H7F3O3 |
| Molecular Weight | 256.17700 |
| Flash Point | 179.3ºC |
| Exact Mass | 256.03500 |
| PSA | 50.44000 |
| LogP | 3.66360 |
| Index of Refraction | 1.511 |
| InChIKey | IJPNRBZMRINMMR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccccc2C(F)(F)F)o1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | 25-36/37/38-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2932190090 |
|
~19%
5-[2-(TRIFLUORO... CAS#:92973-24-5 |
| Literature: Huguet, Florian; Melet, Armelle; Alves de Sousa, Rodolphe; Lieutaud, Aurelie; Chevalier, Jacqueline; Maigre, Laure; Deschamps, Patrick; Tomas, Alain; Leulliot, Nicolas; Pages, Jean-Marie; Artaud, Isabelle ChemMedChem, 2012 , vol. 7, # 6 p. 1020 - 1030 |
|
~83%
5-[2-(TRIFLUORO... CAS#:92973-24-5 |
| Literature: Gorak; Obushak; Matiichuk; Lytvyn Russian Journal of Organic Chemistry, 2009 , vol. 45, # 4 p. 541 - 550 |
![5-[2-(trifluoromethyl)phenyl]furan-2-carboxylic acid methyl ester structure](https://image.chemsrc.com/caspic/148/773874-52-5.png)
![2-[5-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]tetrazol-1-yl]acetic acid structure](https://image.chemsrc.com/caspic/145/92972-82-2.png)
CAS#:92972-82-2| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD02602847 |
| FC3 |
| 2evc |