5-[2-(trifluoromethyl)phenyl]-2-furaldehyde
Modify Date: 2025-08-25 17:30:48
![5-[2-(trifluoromethyl)phenyl]-2-furaldehyde Structure](https://image.chemsrc.com/caspic/128/94098-56-3.png)
5-[2-(trifluoromethyl)phenyl]-2-furaldehyde structure
|
Common Name | 5-[2-(trifluoromethyl)phenyl]-2-furaldehyde | ||
|---|---|---|---|---|
| CAS Number | 94098-56-3 | Molecular Weight | 240.17800 | |
| Density | 1.314g/cm3 | Boiling Point | 331.7ºC at 760 mmHg | |
| Molecular Formula | C12H7F3O2 | Melting Point | 41-44 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-[2-(trifluoromethyl)phenyl]furan-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 331.7ºC at 760 mmHg |
| Melting Point | 41-44 °C(lit.) |
| Molecular Formula | C12H7F3O2 |
| Molecular Weight | 240.17800 |
| Flash Point | >230 °F |
| Exact Mass | 240.04000 |
| PSA | 30.21000 |
| LogP | 3.77790 |
| Index of Refraction | 1.512 |
| InChIKey | BECHPBVVELWRBW-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccccc2C(F)(F)F)o1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932190090 |
|
~%
5-[2-(trifluoro... CAS#:94098-56-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 10 p. 2481 - 2486 |
|
~67%
5-[2-(trifluoro... CAS#:94098-56-3 |
| Literature: Dong, Jia Jia; Roger, Julien; Pogan, Franc; Doucet, Henri Green Chemistry, 2009 , vol. 11, # 11 p. 1832 - 1846 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-[2-(Trifluoromethyl)phenyl]furfural |
| 5-(2-(trifluoromethyl)phenyl)-2-furancarboxaldehyde |
| 5-[2-(trifluoromethyl)phenyl]-2-furaldehyde |
| MFCD00274240 |
| 5-(2-Trifluoromethyl-phenyl)-furan-2-carbaldehyde |