Cerlapirdine
Modify Date: 2025-09-01 10:31:22
Cerlapirdine structure
|
Common Name | Cerlapirdine | ||
|---|---|---|---|---|
| CAS Number | 925448-93-7 | Molecular Weight | 409.50100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CerlapirdineCerlapirdine (SAM-531, PF-05212365) is a selective and potent full antagonist of the 5-hydroxytryptamine 6 (5-HT6) receptor. Cerlapirdine has the potential for researching the Alzheimer's disease[1]. |
| Name | N,N-dimethyl-3-[(3-naphthalen-1-ylsulfonyl-2H-indazol-5-yl)oxy]propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Cerlapirdine (SAM-531, PF-05212365) is a selective and potent full antagonist of the 5-hydroxytryptamine 6 (5-HT6) receptor. Cerlapirdine has the potential for researching the Alzheimer's disease[1]. |
|---|---|
| Related Catalog | |
| Target |
5-HT6 Receptor |
| References |
| Molecular Formula | C22H23N3O3S |
|---|---|
| Molecular Weight | 409.50100 |
| Exact Mass | 409.14600 |
| PSA | 83.67000 |
| LogP | 4.96020 |
| InChIKey | NXQGEDVQXVTCDA-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOc1ccc2n[nH]c(S(=O)(=O)c3cccc4ccccc34)c2c1 |
| SAM-531 |
| UNII-EK40PJ0V49 |
| Cerlapirdine |