LY 2087101
Modify Date: 2025-08-27 11:17:51
LY 2087101 structure
|
Common Name | LY 2087101 | ||
|---|---|---|---|---|
| CAS Number | 913186-74-0 | Molecular Weight | 318.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11FN2OS2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of LY 2087101LY2087101 is an allosteric potentiator of α7, α4β2 and α4β4 nAChRs. LY2087101 displays selectivity against α3β4 nAChRs. |
| Name | {2-[(4-Fluorophenyl)amino]-4-methyl-1,3-thiazol-5-yl}(3-thienyl)m ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11FN2OS2 |
|---|---|
| Molecular Weight | 318.38900 |
| Exact Mass | 318.03000 |
| PSA | 98.47000 |
| LogP | 4.69970 |
| InChIKey | PEAMDZVDNYENPN-UHFFFAOYSA-N |
| SMILES | Cc1nc(Nc2ccc(F)cc2)sc1C(=O)c1ccsc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| Eticlopride hydrochloride |