AZD5099
Modify Date: 2025-08-25 23:05:17
AZD5099 structure
|
Common Name | AZD5099 | ||
|---|---|---|---|---|
| CAS Number | 907543-25-3 | Molecular Weight | 548.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27Cl2N5O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AZD5099AZD5099, an antibacterial agent, is a potent and selective bacterial topoisomerase II inhibitor. AZD5099 potently inhibits the infections caused by Gram-positive and fastidious Gram-negative bacteria[1]. |
| Name | kgzhravdxgquqm-wcqgtbresa-n |
|---|
| Description | AZD5099, an antibacterial agent, is a potent and selective bacterial topoisomerase II inhibitor. AZD5099 potently inhibits the infections caused by Gram-positive and fastidious Gram-negative bacteria[1]. |
|---|---|
| Related Catalog | |
| Target |
Topoisomerase II |
| References |
| Molecular Formula | C21H27Cl2N5O6S |
|---|---|
| Molecular Weight | 548.44 |
| InChIKey | KGZHRAVDXGQUQM-WCQGTBRESA-N |
| SMILES | COCC(C)NC(=O)c1nc(N2CCC(NC(=O)c3[nH]c(C)c(Cl)c3Cl)C(OC)C2)sc1C(=O)O |