FmocNH-PEG3-CH2CH2NH2 hydrochloride
Modify Date: 2025-08-26 15:23:31
FmocNH-PEG3-CH2CH2NH2 hydrochloride structure
|
Common Name | FmocNH-PEG3-CH2CH2NH2 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 906079-91-2 | Molecular Weight | 450.96 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FmocNH-PEG3-CH2CH2NH2 hydrochlorideFmocNH-PEG3-CH2CH2NH2 (hydrochloride) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | FmocNH-PEG3-CH2CH2NH2 hydrochloride |
|---|
| Description | FmocNH-PEG3-CH2CH2NH2 (hydrochloride) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C23H31ClN2O5 |
|---|---|
| Molecular Weight | 450.96 |
| InChIKey | SEZIMCXPIBEZBJ-UHFFFAOYSA-N |
| SMILES | Cl.NCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |