WAY-632963
Modify Date: 2025-08-26 14:30:49
WAY-632963 structure
|
Common Name | WAY-632963 | ||
|---|---|---|---|---|
| CAS Number | 900640-73-5 | Molecular Weight | 237.68548 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 377.5±52.0 °C at 760 mmHg | |
| Molecular Formula | C11H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.1±30.7 °C | |
Use of WAY-632963Aurora kinase A inhibitor |
| Name | WAY-632963 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.5±52.0 °C at 760 mmHg |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.68548 |
| Flash Point | 182.1±30.7 °C |
| Exact Mass | 237.066895 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | KWJMYQSOZZPHLB-UHFFFAOYSA-N |
| SMILES | CCNCc1nc2cc(Cl)ccc2c(=O)[nH]1 |
| MFCD06347925 |
| 7-chloro-2-[(ethylamino)methyl]quinazolin-4(3H)-one |
| 4(1H)-Quinazolinone, 7-chloro-2-[(ethylamino)methyl]- |
| 7-chloro-2-[(ethylamino)methyl]-3,4-dihydroquinazolin-4-one |
| 7-Chloro-2-[(ethylamino)methyl]-4(1H)-quinazolinone |