beta-Rhamnocitrin structure
|
Common Name | beta-Rhamnocitrin | ||
|---|---|---|---|---|
| CAS Number | 90-19-7 | Molecular Weight | 316.26200 | |
| Density | 1.634g/cm3 | Boiling Point | 627.9ºC at 760 mmHg | |
| Molecular Formula | C16H12O7 | Melting Point | 293-296°C (dec.) | |
| MSDS | Chinese USA | Flash Point | 238.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of beta-RhamnocitrinRhamnetin is a quercetin derivative found in Coriandrum sativum, inhibits secretory phospholipase A2, with antioxidant and anti-inflammatory activity[1]. |
| Name | rhamnetin |
|---|---|
| Synonym | More Synonyms |
| Description | Rhamnetin is a quercetin derivative found in Coriandrum sativum, inhibits secretory phospholipase A2, with antioxidant and anti-inflammatory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.634g/cm3 |
|---|---|
| Boiling Point | 627.9ºC at 760 mmHg |
| Melting Point | 293-296°C (dec.) |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.26200 |
| Flash Point | 238.9ºC |
| Exact Mass | 316.05800 |
| PSA | 120.36000 |
| LogP | 2.29100 |
| Index of Refraction | 1.74 |
| InChIKey | JGUZGNYPMHHYRK-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc2c1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | LK8748000 |
| Precursor 7 | |
|---|---|
| DownStream 6 | |
|
A nicotinic receptor-mediated anti-inflammatory effect of the flavonoid rhamnetin in BV2 microglia.
Fitoterapia 98 , 11-21, (2014) The alpha7 nicotinic acetylcholine receptor (nAChR) is a potential target in neuroinflammation. Screening a plant extract library identified Solidago nemoralis as containing methyl-quercetin derivativ... |
|
|
[Non-alkaloid chemical constituents from Coptis chinensis].
Zhongguo Zhong Yao Za Zhi 37(9) , 1241-4, (2012) To separate and identify chemical constituents from Coptis chinensis.The compounds were separated and purified by various chromatographic techniques. Their structures were identified on the basis of t... |
|
|
Cardioprotective effects of rhamnetin in H9c2 cardiomyoblast cells under H₂O₂-induced apoptosis.
J. Ethnopharmacol. 153(3) , 552-60, (2014) Many studies have emphasized that flavonoids, found in various fruits, vegetables, and seeds, as well as tea and red wine, have potential health-promoting and disease-preventing effects. Rhamnetin is ... |
| 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one |
| MFCD00016931 |
| 7-O-Methyl Quercetin |
| EINECS 201-974-1 |