PDE10-IN-5
Modify Date: 2025-08-27 07:28:59
PDE10-IN-5 structure
|
Common Name | PDE10-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 898562-99-7 | Molecular Weight | 460.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H19F3N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PDE10-IN-5PDE10-IN-5 is a phosphodiesterase 10 (PDE 10) inhibitor, can be used for researching certain central nervous system (CNS) disorders[1]. |
| Name | PDE10-IN-5 |
|---|
| Description | PDE10-IN-5 is a phosphodiesterase 10 (PDE 10) inhibitor, can be used for researching certain central nervous system (CNS) disorders[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H19F3N4O |
|---|---|
| Molecular Weight | 460.45 |
| InChIKey | KOQAWTNMUMMWMO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Cn1ncc(-c2ccncc2)c1-c1ccc(OCc2ccc3ccccc3n2)cc1 |