FmocNH-PEG4-t-butyl acetate structure
|
Common Name | FmocNH-PEG4-t-butyl acetate | ||
|---|---|---|---|---|
| CAS Number | 894427-95-3 | Molecular Weight | 529.62200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H39NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FmocNH-PEG4-t-butyl acetateFmocNH-PEG4-t-butyl acetate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | tert-butyl 15-N-(9-fluorenylmethyloxycarbonyl)-15-aza-3,6,9,12-tetraoxa-pentadecanoate |
|---|---|
| Synonym | More Synonyms |
| Description | FmocNH-PEG4-t-butyl acetate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C29H39NO8 |
|---|---|
| Molecular Weight | 529.62200 |
| Exact Mass | 529.26800 |
| PSA | 101.55000 |
| LogP | 4.32410 |
| InChIKey | LUFOHZGUDWQNKB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| tert-butyl 5-N-(9-fluorenylmethyloxycarbonyl)-15-aza-3,6,9,12-tetraoxa-pentadecanoate |