8-epi-Deoxyloganic acid
Modify Date: 2025-08-21 16:18:53
8-epi-Deoxyloganic acid structure
|
Common Name | 8-epi-Deoxyloganic acid | ||
|---|---|---|---|---|
| CAS Number | 88668-99-9 | Molecular Weight | 360.356 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 597.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H24O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9±23.6 °C | |
Use of 8-epi-Deoxyloganic acid8-Epideoxyloganic acid (7-Deoxy-8-epiloganic acid), an iridoid glucoside, can be found in Incarvillea delavayi. 8-Epideoxyloganic acid exhibits weak antinociceptive activity[1]. |
| Name | 8-Epideoxyloganic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 8-Epideoxyloganic acid (7-Deoxy-8-epiloganic acid), an iridoid glucoside, can be found in Incarvillea delavayi. 8-Epideoxyloganic acid exhibits weak antinociceptive activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 597.2±50.0 °C at 760 mmHg |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.356 |
| Flash Point | 217.9±23.6 °C |
| Exact Mass | 360.142029 |
| PSA | 145.91000 |
| LogP | -0.97 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | DSXFHNSGLYXPNG-PKUPRILXSA-N |
| SMILES | CC1CCC2C(C(=O)O)=COC(OC3OC(CO)C(O)C(O)C3O)C12 |
| Hazard Codes | Xi |
|---|
| Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-7-methyl-, (1S,4aS,7R,7aR)- |
| (1S,4aS,7R,7aR)-1-(β-D-Glucopyranosyloxy)-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| 8-epi-Deoxyloganic acid |