m-PEG3-NHS ester
Modify Date: 2025-08-26 19:12:40
m-PEG3-NHS ester structure
|
Common Name | m-PEG3-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 876746-59-7 | Molecular Weight | 289.282 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 393.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9±30.1 °C | |
Use of m-PEG3-NHS esterm-PEG3-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 1-({3-[2-(2-Methoxyethoxy)ethoxy]propanoyl}oxy)-2,5-pyrrolidinedione |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG3-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.7±50.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.282 |
| Flash Point | 191.9±30.1 °C |
| Exact Mass | 289.116150 |
| LogP | -2.51 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | TYCOYHPJUNAABD-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Hazard Codes | Xi |
|---|
| 2,5-Pyrrolidinedione, 1-[3-[2-(2-methoxyethoxy)ethoxy]-1-oxopropoxy]- |
| 1-({3-[2-(2-Methoxyethoxy)ethoxy]propanoyl}oxy)-2,5-pyrrolidinedione |