TCMDC-125457
Modify Date: 2025-08-25 22:51:46
TCMDC-125457 structure
|
Common Name | TCMDC-125457 | ||
|---|---|---|---|---|
| CAS Number | 872113-12-7 | Molecular Weight | 399.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TCMDC-125457TCMDC-125457 is potent in inducing calcium redistribution but minimally inhibits heme crystallization. TCMDC-125457 demonstrated high efficacy when pulsed in a single-dose combination with artesunate against tightly synchronized artemisinin-resistant ring-stage parasites. |
| Name | TCMDC-125457 |
|---|
| Description | TCMDC-125457 is potent in inducing calcium redistribution but minimally inhibits heme crystallization. TCMDC-125457 demonstrated high efficacy when pulsed in a single-dose combination with artesunate against tightly synchronized artemisinin-resistant ring-stage parasites. |
|---|---|
| References |
| Molecular Formula | C19H18ClN5O3 |
|---|---|
| Molecular Weight | 399.83 |
| InChIKey | RHRZUZMCICRKJA-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)c1cnn(-c2ccccc2)n1 |