RA-VII
Modify Date: 2025-08-23 19:40:50
RA-VII structure
|
Common Name | RA-VII | ||
|---|---|---|---|---|
| CAS Number | 86229-97-2 | Molecular Weight | 770.87000 | |
| Density | 1.165g/cm3 | Boiling Point | 1079.1ºC at 760 mmHg | |
| Molecular Formula | C41H50N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 606.4ºC | |
Use of RA-VIIRA-VII is an antitumor agent that exhibits significant activity against L1210, B-16 melanoma, Lewis lung carcinoma, Colon 38 and Ehrlich carcinoma[1]. |
| Name | ra vii |
|---|---|
| Synonym | More Synonyms |
| Description | RA-VII is an antitumor agent that exhibits significant activity against L1210, B-16 melanoma, Lewis lung carcinoma, Colon 38 and Ehrlich carcinoma[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 1079.1ºC at 760 mmHg |
| Molecular Formula | C41H50N6O9 |
| Molecular Weight | 770.87000 |
| Flash Point | 606.4ºC |
| Exact Mass | 770.36400 |
| PSA | 186.39000 |
| LogP | 2.48750 |
| Index of Refraction | 1.534 |
| InChIKey | MBQKTLYFUYNAPZ-FEZMQHRXSA-N |
| SMILES | COc1ccc(CC2C(=O)NC(C)C(=O)N(C)C3Cc4ccc(cc4)Oc4cc(ccc4OC)CC(C(=O)NC(C)C(=O)NC(C)C(=O)N2C)N(C)C3=O)cc1 |
| Serratamolid |
| serratamolide |
| cyclo(D-alanyl-L-alanyl-N,O-dimethyl-L-tyrosyl-L-alanyl-N-methyl-L-tyrosyl-N,O-dimethyl-L-tyrosyl) cyclic 54<*>63 ether |
| (3S)-7t,14t-diheptyl-3r,10c-bis-hydroxymethyl-1,8-dioxa-4,11-diaza-cyclotetradecane-2,5,9,12-tetraone |
| cyclo-(D-3-hydroxy-decanoyl->L-seryl->D-3-hydroxy-decanoyl->L-seryl) |