PF-00337210
Modify Date: 2025-12-01 11:17:47
PF-00337210 structure
|
Common Name | PF-00337210 | ||
|---|---|---|---|---|
| CAS Number | 854514-88-8 | Molecular Weight | 461.51000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF-00337210A potent, selective, ATP-competitive and orally bioavailable inhibitor of VEGFR-2 with Ki of 0.7 and 8.8 nM for unactivated and fully phosphorylated VEGFR-2, respectively. |
| Name | N,2-dimethyl-6{[7-(2-morpholin4-ylethoxy)quinolin-4-yl]oxy}-1-benzofuran-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H27N3O5 |
|---|---|
| Molecular Weight | 461.51000 |
| Exact Mass | 461.19500 |
| PSA | 86.06000 |
| LogP | 4.48110 |
| InChIKey | LGXVKMDGSIWEHL-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1c(C)oc2cc(Oc3ccnc4cc(OCCN5CCOCC5)ccc34)ccc12 |
| N,2-dimethyl-6-[7-(2-morpholinoethoxy)quinolin-4-yloxy]benzofuran-3-carboxamide |