PF-05085727
Modify Date: 2025-08-29 11:49:48
PF-05085727 structure
|
Common Name | PF-05085727 | ||
|---|---|---|---|---|
| CAS Number | 1415637-72-7 | Molecular Weight | 413.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18F3N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF-05085727PF-05085727 is a potent, selective and brain penetrant Phosphodiesterase 2A (PDE2A) inhibitor with an IC50 of 2 nM. |
| Name | PF-05085727 |
|---|
| Description | PF-05085727 is a potent, selective and brain penetrant Phosphodiesterase 2A (PDE2A) inhibitor with an IC50 of 2 nM. |
|---|---|
| Related Catalog | |
| Target |
PDE2A:2 nM (IC50) |
| References |
| Molecular Formula | C20H18F3N7 |
|---|---|
| Molecular Weight | 413.40 |
| InChIKey | SHAVEYUXRBIMLA-UHFFFAOYSA-N |
| SMILES | Cn1ncc(-c2nn(C)c3ncnc(N4CCC4)c23)c1-c1ccc(C(F)(F)F)cc1 |
| Storage condition | 2-8℃ |