Raloxifene Bismethyl Ether
Modify Date: 2025-08-21 17:41:29
Raloxifene Bismethyl Ether structure
|
Common Name | Raloxifene Bismethyl Ether | ||
|---|---|---|---|---|
| CAS Number | 84541-38-8 | Molecular Weight | 501.63600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H31NO4S | Melting Point | 75-85ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of Raloxifene Bismethyl EtherRaloxifene Bismethyl Ether is a metabolite of Raloxifene and an estrogen receptor inactive compound on which both hydroxyl groups are absent[1]. |
| Name | [6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Description | Raloxifene Bismethyl Ether is a metabolite of Raloxifene and an estrogen receptor inactive compound on which both hydroxyl groups are absent[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Raloxifene Bismethyl Ether has no effect on tissue toughness in the ex vivo beam model[1]. |
| References |
| Melting Point | 75-85ºC |
|---|---|
| Molecular Formula | C30H31NO4S |
| Molecular Weight | 501.63600 |
| Exact Mass | 501.19700 |
| PSA | 76.24000 |
| LogP | 6.61910 |
| InChIKey | MSRYQTKAUSVEDP-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2sc3cc(OC)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)cc1 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
CAS#:84541-36-6![[6-methoxy-2-(4-methoxyphenyl)benzo[b]thiophen-3-yl](4-hydroxyphenyl)methanone Structure](https://image.chemsrc.com/caspic/287/63676-19-7.png)
CAS#:63676-19-7
CAS#:2008-75-5
CAS#:3040-44-6
CAS#:13139-86-1![[2-dimethylamino-6-methoxybenzothien-3-yl] [4-[2-(1-piperidinyl)ethoxy]phenyl]-methanone Structure](https://image.chemsrc.com/caspic/333/165742-76-7.png)
CAS#:165742-76-7![6-methoxy-2-(4-methoxyphenyl)-3-(4-nitrobenzoyl)-benzo[b]thiophene Structure](https://image.chemsrc.com/caspic/248/206434-76-6.png)
CAS#:206434-76-6
CAS#:67-56-1
CAS#:84449-90-1| 6-methoxy-2-(4-methoxyphenyl)-3-[4-(2-piperidinylethoxy)benzoyl]benzo[b]thiophene |
| 1-(2-{4-[6-methoxy-2-(4-methoxyphenyl)-benzo[b]thiophene-3-carbonyl]-phenoxy}-ethyl)-piperidine |
| Raloxifene Bismethyl Ether |
| (4-(2-(piperidin-1-yl)ethoxy)phenyl)(6-methoxy-2-(4-methoxyphenyl)benzo[b]thiophen-3-yl)methanone |
| 1-(2-{4-[6-Methoxy-2-(4-methoxy-phenyl)-benzo[b]thiophene-3-carbonyl]-phenoxy}-ethyl)-piperidin |
| [6-methoxy-2-(4-methoxyphenyl)benzo[b]thiophene][4-(2-(piperidin-1-yl)ethoxy)phenyl]methanone |
| 6-methoxy-2-(4-methoxyphenyl)-3-[4-(2-piperidinoethoxy)benzoyl]benzo[b]thiophene |
| [6-Methoxy-2-(4-methoxyphenyl)benzo[b]thien-3-yl][4-[2-(1-piperidinyl)ethoxy]phenyl]methanone |