4-(4-methylsulfonylphenoxy)benzonitrile
Modify Date: 2025-09-21 11:56:30
4-(4-methylsulfonylphenoxy)benzonitrile structure
|
Common Name | 4-(4-methylsulfonylphenoxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 83642-27-7 | Molecular Weight | 273.30700 | |
| Density | 1.35g/cm3 | Boiling Point | 474.7ºC at 760 mmHg | |
| Molecular Formula | C14H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.9ºC | |
| Name | 4-(4-methylsulfonylphenoxy)benzonitrile |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 474.7ºC at 760 mmHg |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.30700 |
| Flash Point | 240.9ºC |
| Exact Mass | 273.04600 |
| PSA | 75.54000 |
| LogP | 3.83488 |
| Index of Refraction | 1.622 |
| InChIKey | AMBZZIOOUCCXPP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(C#N)cc2)cc1 |
|
~27%
4-(4-methylsulf... CAS#:83642-27-7 |
| Literature: The Dow Chemical Company Patent: US4349568 A1, 1982 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |