1-(4-methylsulfonylphenoxy)-4-nitrobenzene structure
|
Common Name | 1-(4-methylsulfonylphenoxy)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 36089-89-1 | Molecular Weight | 293.29500 | |
| Density | 1.372g/cm3 | Boiling Point | 469ºC at 760 mmHg | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.4ºC | |
| Name | 1-(4-methylsulfonylphenoxy)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 469ºC at 760 mmHg |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.29500 |
| Flash Point | 237.4ºC |
| Exact Mass | 293.03600 |
| PSA | 97.57000 |
| LogP | 4.39460 |
| Index of Refraction | 1.595 |
| InChIKey | GQDMKXWXQJKEAD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~99%
1-(4-methylsulf... CAS#:36089-89-1 |
| Literature: LG Life Sciences Ltd. Patent: US2010/210647 A1, 2010 ; Location in patent: Page/Page column 18 ; |
|
~%
1-(4-methylsulf... CAS#:36089-89-1 |
| Literature: Nippon Kagaku Patent: DE2130919 , 1971 ; Chem.Abstr., 1972 , vol. 76, # 85554 |
|
~%
1-(4-methylsulf... CAS#:36089-89-1 |
| Literature: Nippon Kagaku Patent: DE2130919 , 1971 ; Chem.Abstr., 1972 , vol. 76, # 85554 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-(4-methylsulfonylphenoxy)-1-nitrobenzene |
| 4-(4-Methanesulfonyl-phenoxy)nitrobenzene |
| 1-(Methylsulfonyl)-4-(4-nitrophenoxy)benzene |