1-(4-bromobutyl)-4-nitrobenzene structure
|
Common Name | 1-(4-bromobutyl)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 99359-34-9 | Molecular Weight | 258.11200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromobutyl)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12BrNO2 |
|---|---|
| Molecular Weight | 258.11200 |
| Exact Mass | 257.00500 |
| PSA | 45.82000 |
| LogP | 3.83560 |
| InChIKey | GTNVWVLCXAHTCJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCCCBr)cc1 |
|
~96%
1-(4-bromobutyl... CAS#:99359-34-9 |
| Literature: Zou; Kopajtic; Katz; Wirtz; Justice Jr.; Newman Journal of Medicinal Chemistry, 2001 , vol. 44, # 25 p. 4453 - 4461 |
|
~10%
1-(4-bromobutyl... CAS#:99359-34-9 |
| Literature: Bristol-Myers Squibb Pharma Company Patent: EP892780 B1, 2002 ; |
|
~%
1-(4-bromobutyl... CAS#:99359-34-9 |
| Literature: Zou; Kopajtic; Katz; Wirtz; Justice Jr.; Newman Journal of Medicinal Chemistry, 2001 , vol. 44, # 25 p. 4453 - 4461 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(4-nitrophenyl)butyl bromide |
| 1-bromo-4-(4-nitrophenyl)butane |
| 1-(4-Brom-butyl)-4-nitro-benzol |
| 1-(4-bromo-butyl)-4-nitro-benzene |
| Benzene,1-(4-bromobutyl)-4-nitro |