Potassium 6-hydroxy-2-naphthalenesulfonate structure
|
Common Name | Potassium 6-hydroxy-2-naphthalenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 833-66-9 | Molecular Weight | 262.323 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7KO4S | Melting Point | 155-157 (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Potassium 6-Hydroxy-2-naphthalenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 155-157 (dec.) |
|---|---|
| Molecular Formula | C10H7KO4S |
| Molecular Weight | 262.323 |
| Exact Mass | 261.970215 |
| PSA | 85.81000 |
| LogP | 2.53030 |
| InChIKey | PZWWSVPMGHDZNJ-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])c1ccc2cc(O)ccc2c1.[K+] |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. R38:Irritating to the skin. |
| Safety Phrases | S36 |
| WGK Germany | 3 |
| RTECS | UX9280000 |
| HS Code | 2908999090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Naphthalenesulfonic acid, 6-hydroxy-, monopotassium salt |
| 2-Naphthol-6-sulfonic acid potassium salt |
| 2-Naphthalenesulfonic acid, 6-hydroxy-, potassium salt (1:1) |
| Potassium 6-hydroxy-2-naphthalenesulfonate |
| potassium 6-hydroxynaphthalene-2-sulfonate |
| EINECS 212-631-0 |
| MFCD06797149 |