4-O-Galloylbergenin structure
|
Common Name | 4-O-Galloylbergenin | ||
|---|---|---|---|---|
| CAS Number | 82958-45-0 | Molecular Weight | 480.376 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 898.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C21H20O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.2±27.8 °C | |
Use of 4-O-Galloylbergenin4-O-Galloylbergenin is a bergenin derivative that can be isolated from the rhizome of Ardisia gigantifolia[1]. |
| Name | (2R,3R,4S,4aS,10bS)-3,8,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-6-oxo-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]isochromen-4-yl 3,4,5-trihydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | 4-O-Galloylbergenin is a bergenin derivative that can be isolated from the rhizome of Ardisia gigantifolia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 898.8±65.0 °C at 760 mmHg |
| Molecular Formula | C21H20O13 |
| Molecular Weight | 480.376 |
| Flash Point | 315.2±27.8 °C |
| Exact Mass | 480.090393 |
| PSA | 212.67000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.763 |
| InChIKey | QKSHSFQTWCKTFV-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2c(c1O)C1OC(CO)C(O)C(OC(=O)c3cc(O)c(O)c(O)c3)C1OC2=O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 4 | |
| Benzoic acid, 3,4,5-trihydroxy-, (2R,3R,4S,4aS,10bS)-2,3,4,4a,6,10b-hexahydro-3,8,10-trihydroxy-2-(hydroxymethyl)-9-methoxy-6-oxopyrano[3,2-c][2]benzopyran-4-yl ester |
| (2R,3R,4S,4aS,10bS)-3,8,10-Trihydroxy-2-(hydroxymethyl)-9-methoxy-6-oxo-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]isochromen-4-yl 3,4,5-trihydroxybenzoate |