8-Epiloganic acid
Modify Date: 2025-08-27 09:22:06
8-Epiloganic acid structure
|
Common Name | 8-Epiloganic acid | ||
|---|---|---|---|---|
| CAS Number | 82509-41-9 | Molecular Weight | 376.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24O10 | Melting Point | 138-139 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of 8-Epiloganic acid8-Epiloganic acid, an iridoid glucoside, can be found in Linaria cymbalaria (Scrophulariaceae)[1]. |
| Name | loganic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 8-Epiloganic acid, an iridoid glucoside, can be found in Linaria cymbalaria (Scrophulariaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 138-139 °C |
|---|---|
| Molecular Formula | C16H24O10 |
| Molecular Weight | 376.35600 |
| Exact Mass | 376.13700 |
| PSA | 166.14000 |
| InChIKey | JNNGEAWILNVFFD-OZFVSFPVSA-N |
| SMILES | CC1C(O)CC2C(C(=O)O)=COC(OC3OC(CO)C(O)C(O)C3O)C21 |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
![(4R)-Hexahydro-6α-hydroxy-4β-(hydroxymethyl)-7α-methylcyclopenta[c]pyran-3(4H)-one structure](https://image.chemsrc.com/caspic/260/132237-63-9.png)
CAS#:132237-63-9![(4S)-Hexahydro-6α-hydroxy-4α-(hydroxymethyl)-7α-methylcyclopenta[c]pyran-3(4H)-one structure](https://image.chemsrc.com/caspic/071/132339-37-8.png)
CAS#:132339-37-8
CAS#:18524-94-2| Loganic acid |
| 8-hydroxy-10-hydrosweroside |