halazone structure
|
Common Name | halazone | ||
|---|---|---|---|---|
| CAS Number | 80-13-7 | Molecular Weight | 270.09000 | |
| Density | 1.717 g/cm3 | Boiling Point | 437ºC at 760 mmHg | |
| Molecular Formula | C7H5Cl2NO4S | Melting Point | 213ºC | |
| MSDS | N/A | Flash Point | 218.1ºC | |
Use of halazoneHalazone is an atypical antimicrobial sulfonamide derivative and a carbonic anhydrase II inhibitor with a Kd value of 1.45 µM. Halazone protects sodium channels from inactivation. Halazone is widely used for disinfection of drinking water[1][2]. |
| Name | Halazone |
|---|---|
| Synonym | More Synonyms |
| Description | Halazone is an atypical antimicrobial sulfonamide derivative and a carbonic anhydrase II inhibitor with a Kd value of 1.45 µM. Halazone protects sodium channels from inactivation. Halazone is widely used for disinfection of drinking water[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Halazone is chemically closely related to Chloramine-T, the nitrogen atom is linked with two instead of one chlorine atom and, certainly more important here, a methyl group is replaced by a carboxyl group. The effect of Halazone on the sodium current is studied in voltage-clamped single nerve fibers of the frog. The oxidant Halazone drastically inhibits inactivation[1]. |
| References |
| Density | 1.717 g/cm3 |
|---|---|
| Boiling Point | 437ºC at 760 mmHg |
| Melting Point | 213ºC |
| Molecular Formula | C7H5Cl2NO4S |
| Molecular Weight | 270.09000 |
| Flash Point | 218.1ºC |
| Exact Mass | 268.93200 |
| PSA | 83.06000 |
| LogP | 2.76390 |
| InChIKey | XPDVQPODLRGWPL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(Cl)Cl)cc1 |
| Stability | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Hazard Codes | T+ |
|---|---|
| RIDADR | 1479 |
| WGK Germany | 3 |
| RTECS | DG8050000 |
| Packaging Group | III |
| Hazard Class | 5.1 |
| HS Code | 2935009090 |
|
~95%
halazone CAS#:80-13-7 |
| Literature: Saljoughian, M.; Sadeghi, M. T. Monatshefte fuer Chemie, 1986 , vol. 117, p. 553 - 556 |
|
~%
halazone CAS#:80-13-7 |
|
Literature: A Handbook of Antiseptics |
|
~%
halazone CAS#:80-13-7 |
| Literature: DE318899 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 769 |
|
~%
halazone CAS#:80-13-7 |
|
Literature: A Handbook of Antiseptics |
|
~%
halazone CAS#:80-13-7 |
|
Literature: A Handbook of Antiseptics |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Pantocide |
| Benzoesaeure-(sulfonsaeure-(4)-dichloramid) |
| Gynamide |
| EINECS 201-253-1 |
| Zeptabs |
| p-Dichlorsulfamid-benzoesaeure |
| Halazon |
| Pantosid |
| Pentocid |
| 4-dichlorosulfamoyl-benzoic acid |
| PANTOCID |
| 4-Dichlorsulfamoyl-benzoesaeure |
| Halozone |
| MFCD00045858 |
| 4-[(dichloroamino)sulfonyl]-benzoic acid |