1-O-Galloyl-2-O-cinnamoyl-glucose structure
|
Common Name | 1-O-Galloyl-2-O-cinnamoyl-glucose | ||
|---|---|---|---|---|
| CAS Number | 791836-69-6 | Molecular Weight | 462.4 | |
| Density | N/A | Boiling Point | 800.8±65.0 °C(Predicted) | |
| Molecular Formula | C22H22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-O-Galloyl-2-O-cinnamoyl-glucose1-O-Galloyl-2-O-cinnamoyl-glucose is a natural compound that could be found in R. palmatum L.[1]. |
| Name | 2-O-cinnamoyl-1-O-galloyl-β-D-glucose |
|---|
| Description | 1-O-Galloyl-2-O-cinnamoyl-glucose is a natural compound that could be found in R. palmatum L.[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 800.8±65.0 °C(Predicted) |
|---|---|
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.4 |
| InChIKey | FISMJUPMCGKNNX-VOTSOKGWSA-N |
| SMILES | O=C(C=Cc1ccccc1)OC1C(OC(=O)c2cc(O)c(O)c(O)c2)OC(CO)C(O)C1O |
| Hazard Codes | Xi |
|---|