WAY-637685 structure
|
Common Name | WAY-637685 | ||
|---|---|---|---|---|
| CAS Number | 790719-57-2 | Molecular Weight | 247.72 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 397.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2±27.9 °C | |
Use of WAY-637685active against PfDHODH resistant mutants |
| Name | WAY-637685 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.5±42.0 °C at 760 mmHg |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 |
| Flash Point | 194.2±27.9 °C |
| Exact Mass | 247.076385 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | KGTWFPWIBRCBCI-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(Cc2ccccc2Cl)c[nH]c1C |
| MFCD06359535 |
| 1-[4-(2-Chlorobenzyl)-2-methyl-1H-pyrrol-3-yl]ethanone |
| Ethanone, 1-[4-[(2-chlorophenyl)methyl]-2-methyl-1H-pyrrol-3-yl]- |
| TCMDC-125433 |