4,4'-Propane-2,2-diylbis(2-methylphenol) structure
|
Common Name | 4,4'-Propane-2,2-diylbis(2-methylphenol) | ||
|---|---|---|---|---|
| CAS Number | 79-97-0 | Molecular Weight | 256.340 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 389.8±0.0 °C at 760 mmHg | |
| Molecular Formula | C17H20O2 | Melting Point | 138-140 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 190.6±21.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,2-Bis(4-hydroxy-3-methylphenyl)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.8±0.0 °C at 760 mmHg |
| Melting Point | 138-140 °C(lit.) |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.340 |
| Flash Point | 190.6±21.9 °C |
| Exact Mass | 256.146332 |
| PSA | 40.46000 |
| LogP | 4.35 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | YMTYZTXUZLQUSF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)c2ccc(O)c(C)c2)ccc1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | GP1750000 |
| HS Code | 2907299090 |
|
~%
4,4'-Propane-2,... CAS#:79-97-0 |
| Literature: Journal of the Indian Chemical Society, , vol. 66, # 2 p. 85 - 90 |
|
~%
4,4'-Propane-2,... CAS#:79-97-0 |
| Literature: US2858343 , ; |
|
~%
4,4'-Propane-2,... CAS#:79-97-0 |
| Literature: US2884462 , ; |
|
~%
4,4'-Propane-2,... CAS#:79-97-0 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 400, p. 33 |
| Precursor 5 | |
|---|---|
| DownStream 8 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|
Screening of bisphenol A, triclosan and paraben analogues as modulators of the glucocorticoid and androgen receptor activities.
Toxicol. In Vitro 29(1) , 8-15, (2014) A homeostasis of the glucocorticoid and androgen endocrine system is essential to human health. Their disturbance can lead to various diseases, for example cardiovascular, inflammatory and autoimmune ... |
|
|
Denshi Shashin Gakkaishi 32 , 18, (1993)
|
|
|
Chem. Abstr. 119 , 259352g, (1993)
|
| EINECS 201-240-0 |
| 4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol |
| Phenol, 4,4'-(1-methylethylidene)bis[2-methyl- |
| 4,4'-Propane-2,2-diylbis(2-methylphenol) |
| 4-[1-(4-hydroxy-3-methylphenyl)-1-methylethyl]-2-methylphenol |
| MFCD00002232 |
| 4,4'-(2,2-Propanediyl)bis(2-methylphenol) |