methyl 2-[(2,2-dichloroacetyl)amino]benzoate structure
|
Common Name | methyl 2-[(2,2-dichloroacetyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 78987-53-8 | Molecular Weight | 262.08900 | |
| Density | 1.427g/cm3 | Boiling Point | 410.6ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.1ºC | |
| Name | methyl 2-[(2,2-dichloroacetyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 410.6ºC at 760 mmHg |
| Molecular Formula | C10H9Cl2NO3 |
| Molecular Weight | 262.08900 |
| Flash Point | 202.1ºC |
| Exact Mass | 260.99600 |
| PSA | 55.40000 |
| LogP | 2.28840 |
| Index of Refraction | 1.59 |
| InChIKey | FQTDUIHZSPAZGM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)C(Cl)Cl |
|
~%
methyl 2-[(2,2-... CAS#:78987-53-8 |
| Literature: Sweeny,A. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 359 - 361 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Dichloracetamido-methyl-anthranilat |