methyl 2-[(2,2-dimethyl-1-oxopropyl)amino]benzoate structure
|
Common Name | methyl 2-[(2,2-dimethyl-1-oxopropyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 84540-62-5 | Molecular Weight | 235.27900 | |
| Density | 1.12g/cm3 | Boiling Point | 393.3ºC at 760 mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | methyl 2-(2,2-dimethylpropanoylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760 mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.27900 |
| Flash Point | 191.7ºC |
| Exact Mass | 235.12100 |
| PSA | 58.89000 |
| LogP | 3.10730 |
| Index of Refraction | 1.542 |
| InChIKey | TWDCYCSGTBPHFH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)(C)C |
| HS Code | 2924299090 |
|---|
|
~10%
methyl 2-[(2,2-... CAS#:84540-62-5 |
| Literature: Yamakawa; Matsukura; Nomura; Yoshioka; Masaki; Igata; Okabe Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 7 p. 1746 - 1752 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 283-156-4 |
| methyl N-trimethylacetylanthranilate |
| N-Pivaloylamino-benzoesaeure-methylester |
| N-Pivaloyl-anthranilsaeure-methylester |