methyl 2-[[2-[(2-methoxycarbonylphenyl)carbamoyl]-3-phenyl-prop-2-enoy l]amino]benzoate
Modify Date: 2025-08-27 18:33:55
![methyl 2-[[2-[(2-methoxycarbonylphenyl)carbamoyl]-3-phenyl-prop-2-enoy l]amino]benzoate Structure](https://image.chemsrc.com/caspic/271/87285-83-4.png)
methyl 2-[[2-[(2-methoxycarbonylphenyl)carbamoyl]-3-phenyl-prop-2-enoy l]amino]benzoate structure
|
Common Name | methyl 2-[[2-[(2-methoxycarbonylphenyl)carbamoyl]-3-phenyl-prop-2-enoy l]amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 87285-83-4 | Molecular Weight | 458.46300 | |
| Density | 1.331g/cm3 | Boiling Point | 727.1ºC at 760 mmHg | |
| Molecular Formula | C26H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.6ºC | |
| Name | methyl 2-[[2-[(2-methoxycarbonylphenyl)carbamoyl]-3-phenylprop-2-enoyl]amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 727.1ºC at 760 mmHg |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.46300 |
| Flash Point | 393.6ºC |
| Exact Mass | 458.14800 |
| PSA | 117.78000 |
| LogP | 5.21960 |
| Index of Refraction | 1.669 |
| InChIKey | OJETUJZMPJDQAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)C(=Cc1ccccc1)C(=O)Nc1ccccc1C(=O)OC |
|
~40%
methyl 2-[[2-[(... CAS#:87285-83-4 |
| Literature: Black, David St. C.; Blatt, Harry; Vanderzalm, Corrie H. Bos; Liepa, Andris J. Australian Journal of Chemistry, 1983 , vol. 36, # 6 p. 1133 - 1140 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| methyl 2-[[2-[(2-methoxycarbonylphenyl)carbamoyl]-3-phenyl-prop-2-enoyl]amino]benzoate |
| dimethyl 2,2'-(benzylidenemalonyldiimino)bisbenzoate |
| Benzoic acid,2,2'-((1,3-dioxo-2-(phenylmethylene)-1,3-propanediyl)diiino)bis-,dimethyl ester |