Longikaurin E structure
|
Common Name | Longikaurin E | ||
|---|---|---|---|---|
| CAS Number | 77949-42-9 | Molecular Weight | 390.470 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 540.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8±23.6 °C | |
Use of Longikaurin ELongikaurin E is a diterpenoids compound isolated from the leaves of Rabdosia ternifolia (D. Don)[1]. |
| Name | Longikaurin E |
|---|---|
| Synonym | More Synonyms |
| Description | Longikaurin E is a diterpenoids compound isolated from the leaves of Rabdosia ternifolia (D. Don)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 540.1±50.0 °C at 760 mmHg |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.470 |
| Flash Point | 185.8±23.6 °C |
| Exact Mass | 390.204254 |
| PSA | 93.06000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | VLCMAXYGZMNIMT-XAYYUQSBSA-N |
| SMILES | C=C1C(=O)C23CC1CC(OC(C)=O)C2C12CCCC(C)(C)C1C(O)C3(O)OC2 |
| Hazard Codes | Xi |
|---|
| (5β,6β,7β,8α,9β,10α,11α,13α)-6,7-Dihydroxy-15-oxo-7,20-epoxykaur-16-en-11-yl acetate |