2-(3-chloro-2-nitrophenyl)acetonitrile structure
|
Common Name | 2-(3-chloro-2-nitrophenyl)acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 77158-79-3 | Molecular Weight | 196.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-chloro-2-nitrophenyl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5ClN2O2 |
|---|---|
| Molecular Weight | 196.59000 |
| Exact Mass | 196.00400 |
| PSA | 69.61000 |
| LogP | 2.83748 |
| InChIKey | WYXXEPGTXNKNTF-UHFFFAOYSA-N |
| SMILES | N#CCc1cccc(Cl)c1[N+](=O)[O-] |
|
~10%
2-(3-chloro-2-n... CAS#:77158-79-3 |
| Literature: Makosza, Mieczyslaw; Wenaell, Maria; Golinski, Miroslaw; Kinowski, Andrzej Bulletin of the Polish Academy of Sciences, Chemistry, 1985 , vol. 33, # 9-10 p. 427 - 432 |
|
~%
2-(3-chloro-2-n... CAS#:77158-79-3 |
| Literature: Makosza, Mieczyslaw; Golinski, Jerzy; Baran, Janusz Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1488 - 1494 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzeneacetonitrile,3-chloro-2-nitro |