Mal-amido-PEG2-C2-acid
Modify Date: 2025-08-25 15:46:53
Mal-amido-PEG2-C2-acid structure
|
Common Name | Mal-amido-PEG2-C2-acid | ||
|---|---|---|---|---|
| CAS Number | 756525-98-1 | Molecular Weight | 328.318 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 617.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H20N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.2±31.5 °C | |
Use of Mal-amido-PEG2-C2-acidMal-amido-PEG2-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | MAL-PEG2-COOH |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-amido-PEG2-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 617.3±55.0 °C at 760 mmHg |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.318 |
| Flash Point | 327.2±31.5 °C |
| Exact Mass | 328.127045 |
| LogP | -1.54 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | GBPJQBDDYXDSNH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| Storage condition | 2-8°C |
| Propanoic acid, 3-[2-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]ethoxy]- |
| 3-[2-(2-{[3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoyl]amino}ethoxy)ethoxy]propanoic acid |