Biotin-PEG4-Hydrazide
Modify Date: 2025-08-27 14:44:01
Biotin-PEG4-Hydrazide structure
|
Common Name | Biotin-PEG4-Hydrazide | ||
|---|---|---|---|---|
| CAS Number | 756525-97-0 | Molecular Weight | 505.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H39N5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG4-HydrazideBiotin-PEG4-hydrazide is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Biotin-PEG4-hydrazide |
|---|---|
| Synonym | More Synonyms |
| Description | Biotin-PEG4-hydrazide is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C21H39N5O7S |
|---|---|
| Molecular Weight | 505.63 |
| InChIKey | PSBJJOWIACLJAQ-ZWOKBUDYSA-N |
| SMILES | NNC(=O)CCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| MFCD09952658 |