Usnic acid structure
|
Common Name | Usnic acid | ||
|---|---|---|---|---|
| CAS Number | 7562-61-0 | Molecular Weight | 344.315 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 638.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O7 | Melting Point | 201-203 °C(lit.) | |
| MSDS | USA | Flash Point | 236.0±25.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Usnic acid(+)-Usnic acid is isolated from isolated from lichens, binds at the ATP-binding pocket of mTOR, and inhibits mTORC1/2 activity. (+)-Usnic acid inhibits the phosphorylation of mTOR downstream effectors: Akt (Ser473), 4EBP1, S6K, induces autophay, with anti-cancer activity[1]. |
| Name | (+)-usnic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Usnic acid is isolated from isolated from lichens, binds at the ATP-binding pocket of mTOR, and inhibits mTORC1/2 activity. (+)-Usnic acid inhibits the phosphorylation of mTOR downstream effectors: Akt (Ser473), 4EBP1, S6K, induces autophay, with anti-cancer activity[1]. |
|---|---|
| Related Catalog | |
| Target |
mTORC1 mTORC2 |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 638.2±55.0 °C at 760 mmHg |
| Melting Point | 201-203 °C(lit.) |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.315 |
| Flash Point | 236.0±25.0 °C |
| Exact Mass | 344.089600 |
| PSA | 121.13000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | WEYVVCKOOFYHRW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3C2(C)C1=O |
| Storage condition | 2~8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Proton-shuttling lichen compound usnic acid affects mitochondrial and lysosomal function in cancer cells.
PLoS ONE 7 , e51296, (2012) The lichen compound usnic acid (UA) is a lipophilic weak acid that acts as a proton shuttle and causes loss of mitochondrial inner membrane potential. In the current study we show that UA treatment in... |
| Usnic acid |
| EINECS 231-456-0 |
| (+)-Usniacin |
| (9bR)-2,6-Diacetyl-1,7,9-trihydroxy-8,9b-dimethyldibenzo[b,d]furan-3(9bH)-one |
| 3(9bH)-Dibenzofuranone, 2,6-diacetyl-1,7,9-trihydroxy-8,9b-dimethyl-, (9bR)- |
| MFCD00016878 |
| D-Usnic acid |