N-acetyl-α-D-glucosamine structure
|
Common Name | N-acetyl-α-D-glucosamine | ||
|---|---|---|---|---|
| CAS Number | 7512-17-6 | Molecular Weight | 221.208 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 595.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H15NO6 | Melting Point | 201-204ºC | |
| MSDS | Chinese USA | Flash Point | 313.9±30.1 °C | |
Use of N-acetyl-α-D-glucosamineN-Acetyl-D-Glucosamine is a monosaccharide derivative of glucose. |
| Name | N-acetyl-D-glucosamine |
|---|---|
| Synonym | More Synonyms |
| Description | N-Acetyl-D-Glucosamine is a monosaccharide derivative of glucose. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 595.4±50.0 °C at 760 mmHg |
| Melting Point | 201-204ºC |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.208 |
| Flash Point | 313.9±30.1 °C |
| Exact Mass | 221.089935 |
| PSA | 127.09000 |
| LogP | -2.48 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | MBLBDJOUHNCFQT-LXGUWJNJSA-N |
| SMILES | CC(=O)NC(C=O)C(O)C(O)C(O)CO |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Structural studies and biosynthetic aspects of the O-antigen polysaccharide from Escherichia coli O42.
Carbohydr. Res. 403 , 174-81, (2015) The structure of the O-antigen polysaccharide (PS) from Escherichia coli O42 has been investigated by NMR spectroscopy as the main method, which was complemented with sugar analysis, mass spectrometry... |
|
|
Melanoma cells homing to the brain: an in vitro model.
Biomed Res. Int. 2015 , 476069, (2015) We developed an in vitro contact through-feet blood brain barrier (BBB) model built using type IV collagen, rat astrocytes, and human umbilical vein endothelial cells (HUVECs) cocultured through Trans... |
|
|
Substrates specialization in lipid compounds and hydrocarbons of Marinobacter genus.
Environ. Sci. Pollut. Res. Int. 22 , 15347-59, (2015) The impact of petroleum contamination and of burrowing macrofauna on abundances of Marinobacter and denitrifiers was tested in marine sediment mesocoms after 3 months incubation. Quantification of thi... |
| N-acetylglucosamine |
| α-D-GlcNAc |
| Glucosamine, N-acetyl- |
| 2-acetylamino-2-deoxy-a-D-glucopyranose |
| 2-acetylamino-2-deoxy-α-D-glucopyranose |
| D-Glucose, 2-acetamido-2-deoxy- |
| N-ACETYL-D-GLUCOSAMINE |
| N-acetyl D-glucosamine |
| MFCD00136044 |
| 2-Acetamido-2-deoxy-α-D-glucopyranose |
| α-GlcNAc |
| 2-Acetamido-2-deoxy-a-D-glucopyranose |
| N-acetyl-δ-glucosamine |
| α-D-Glucopyranose, 2-(acetylamino)-2-deoxy- |
| EINECS 231-368-2 |
| 2-(acetylamino)-2-deoxy-α-D-glucopyranose |
| 2-acetamido-2-deoxy-α-δ-glucopyranose |
| α-N-Acetyl-D-glucosamine |