WAY-621810
Modify Date: 2025-09-26 10:27:51
WAY-621810 structure
|
Common Name | WAY-621810 | ||
|---|---|---|---|---|
| CAS Number | 741734-32-7 | Molecular Weight | 298.7 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 515.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C11H7ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.7±30.1 °C | |
Use of WAY-621810inhibitor of Mcl-1 |
| Name | WAY-621810 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 515.7±50.0 °C at 760 mmHg |
| Molecular Formula | C11H7ClN2O4S |
| Molecular Weight | 298.7 |
| Flash Point | 265.7±30.1 °C |
| Exact Mass | 297.981506 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | CKTKFEWOMQQSNQ-UHFFFAOYSA-N |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])c1ccc(Cl)s1 |
| Ethanone, 1-(5-chloro-2-thienyl)-2-[(2-nitro-3-pyridinyl)oxy]- |
| 1-(5-Chloro-2-thienyl)-2-[(2-nitro-3-pyridinyl)oxy]ethanone |
| MFCD04640068 |