4-[3-(4-Hydroxyphenyl)propyl]-3-methoxyphenol structure
|
Common Name | 4-[3-(4-Hydroxyphenyl)propyl]-3-methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 73731-86-9 | Molecular Weight | 258.31 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 439.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7±25.9 °C | |
Use of 4-[3-(4-Hydroxyphenyl)propyl]-3-methoxyphenolBroussonin B is a phenolic compound isolated from the stem barks of Broussonetia kanzinoki (Moraceae). Broussonin B inhibits adipocyte differentiation in 3T3-L1 cells[1]. |
| Name | Broussonin B |
|---|---|
| Synonym | More Synonyms |
| Description | Broussonin B is a phenolic compound isolated from the stem barks of Broussonetia kanzinoki (Moraceae). Broussonin B inhibits adipocyte differentiation in 3T3-L1 cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.7±35.0 °C at 760 mmHg |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31 |
| Flash Point | 219.7±25.9 °C |
| Exact Mass | 258.125580 |
| PSA | 49.69000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | CJJJQWAYMRTLJT-UHFFFAOYSA-N |
| SMILES | COc1cc(O)ccc1CCCc1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|
| Phenol, 4-[3-(4-hydroxyphenyl)propyl]-3-methoxy- |
| 4-[3-(4-Hydroxyphenyl)propyl]-3-methoxyphenol |