WAY-620595 structure
|
Common Name | WAY-620595 | ||
|---|---|---|---|---|
| CAS Number | 733788-35-7 | Molecular Weight | 497.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H23N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-620595modulator of insect olfactory receptors; altering the lifespan of a eukaryotic organism; |
| Name | WAY-620595 |
|---|
| Molecular Formula | C27H23N5O3S |
|---|---|
| Molecular Weight | 497.57 |
| InChIKey | JVWQGUZYJQUFLY-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(CSc3nnc(-c4cccnc4)n3-c3ccc(C)cc3C)cc(=O)oc2c1 |