2-(2-chloro-2H-pyridin-1-yl)-1-(4-methoxyphenyl)ethanone structure
|
Common Name | 2-(2-chloro-2H-pyridin-1-yl)-1-(4-methoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7250-09-1 | Molecular Weight | 342.61600 | |
| Density | 1.25g/cm3 | Boiling Point | 449.6ºC at 760 mmHg | |
| Molecular Formula | C14H13BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 2-(2-chloropyridin-1-ium-1-yl)-1-(4-methoxyphenyl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760 mmHg |
| Molecular Formula | C14H13BrClNO2 |
| Molecular Weight | 342.61600 |
| Flash Point | 225.7ºC |
| Exact Mass | 340.98200 |
| PSA | 30.18000 |
| Index of Refraction | 1.6 |
| InChIKey | ZNYKURWDYHBADM-UHFFFAOYSA-M |
| SMILES | COc1ccc(C(=O)C[n+]2ccccc2Cl)cc1.[Br-] |
|
~%
2-(2-chloro-2H-... CAS#:7250-09-1 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1472 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Chlor-1-(4-methoxy-phenacyl)-pyridinium,Bromid |
| 2-chloro-1-(4-methoxy-phenacyl)-pyridinium,bromide |