2-(2-chloro-2H-pyridin-1-yl)-1-tetralin-2-yl-ethanone structure
|
Common Name | 2-(2-chloro-2H-pyridin-1-yl)-1-tetralin-2-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 6271-67-6 | Molecular Weight | 366.68000 | |
| Density | 1.22g/cm3 | Boiling Point | 490.8ºC at 760 mmHg | |
| Molecular Formula | C17H17BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 2-(2-chloropyridin-1-ium-1-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 490.8ºC at 760 mmHg |
| Molecular Formula | C17H17BrClNO |
| Molecular Weight | 366.68000 |
| Flash Point | 250.6ºC |
| Exact Mass | 365.01800 |
| PSA | 20.95000 |
| LogP | 0.39320 |
| Index of Refraction | 1.619 |
| InChIKey | CBSXYHYDQGKIGE-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccccc1Cl)c1ccc2c(c1)CCCC2.[Br-] |
|
~%
2-(2-chloro-2H-... CAS#:6271-67-6 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1472 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-CHLOROPYRIDIN-1-IUM-1-YL)-1-(5,6,7,8-TETRAHYDRONAPHTHALEN-2-YL)ETHANONE BROMIDE |
| 2-Chlor-1-[2-oxo-2-(5,6,7,8-tetrahydro-[2]naphthyl)-aethyl]-pyridinium,Bromid |
| 2-chloro-1-[2-oxo-2-(5,6,7,8-tetrahydro-[2]naphthyl)-ethyl]-pyridinium,bromide |