Procaterol structure
|
Common Name | Procaterol | ||
|---|---|---|---|---|
| CAS Number | 72332-33-3 | Molecular Weight | 290.36 | |
| Density | 1.191 g/cm3 | Boiling Point | 539.5ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O3 | Melting Point | 170-173 °C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of ProcaterolProcaterol is an oral selective β2 adrenergic receptor agonist. Procaterol inhibits eosinophil migration and the release of eosinophil chemotactic factor from BEAS-2B cells through a cyclic AMP-dependent mechanism. Procaterol has a large dose difference existing between the bronchodilator effect and the anabolic effect in rat, can be used for asthma research in athletes[1]. |
| Name | (R*,S*)-(-)-8-Hydroxy-5-(1-hydroxy-2-((1-methylethyl)amino)butyl)-2(1H)-quinolinone |
|---|---|
| Synonym | More Synonyms |
| Description | Procaterol is an oral selective β2 adrenergic receptor agonist. Procaterol inhibits eosinophil migration and the release of eosinophil chemotactic factor from BEAS-2B cells through a cyclic AMP-dependent mechanism. Procaterol has a large dose difference existing between the bronchodilator effect and the anabolic effect in rat, can be used for asthma research in athletes[1]. |
|---|---|
| Related Catalog | |
| Target |
β2 adrenoceptor |
| References |
| Density | 1.191 g/cm3 |
|---|---|
| Boiling Point | 539.5ºC at 760 mmHg |
| Melting Point | 170-173 °C(lit.) |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 |
| Exact Mass | 290.16300 |
| PSA | 85.35000 |
| LogP | 2.43460 |
| InChIKey | FKNXQNWAXFXVNW-BLLLJJGKSA-N |
| SMILES | CCC(NC(C)C)C(O)c1ccc(O)c2[nH]c(=O)ccc12 |
| Storage condition | -20°C |
| Water Solubility | 3000 g/L (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37-S37/39 |
| WGK Germany | 1 |
| RTECS | IQ0220000 |
| HS Code | 29211190 |
| HS Code | 29211190 |
|---|
| 8-hydroxy-5-(1-hydroxy-2-((1-methylethyl)amino)butyl)-2(1h)-quinolinone(r*,s |
| EINECS 276-590-0 |
| s*)-(+-) |
| PROCATEROL |
| ent-Florfenicol AMine-d3 |
| (S)-N,N-DiMethyl-3-(1-naphthalenyl-d7-oxy)-3-(2-thienyl)propanaMine |
| MFCD01750015 |