WAY-270329
Modify Date: 2024-04-06 10:55:14
WAY-270329 structure
|
Common Name | WAY-270329 | ||
|---|---|---|---|---|
| CAS Number | 721964-51-8 | Molecular Weight | 423.5 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H18FN5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-270329inhibitor of protein kinases |
| Name | WAY-270329 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H18FN5O2S |
| Molecular Weight | 423.5 |
| Exact Mass | 423.116516 |
| LogP | 4.51 |
| Index of Refraction | 1.675 |
| InChIKey | DYSBYAQONKIWMX-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2nnc3ccc(SCC(=O)Nc4ccc(F)cc4)nn23)cc1 |
| Acetamide, 2-[[3-(4-ethoxyphenyl)-1,2,4-triazolo[4,3-b]pyridazin-6-yl]thio]-N-(4-fluorophenyl)- |
| 2-{[3-(4-Ethoxyphenyl)[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl}-N-(4-fluorophenyl)acetamide |