WAY-270318
Modify Date: 2025-11-02 23:28:52
WAY-270318 structure
|
Common Name | WAY-270318 | ||
|---|---|---|---|---|
| CAS Number | 721964-48-3 | Molecular Weight | 286.35216 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-270318altering the lifespan of a eukaryotic organism; inhibitor of protein kinases; |
| Name | WAY-270318 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N4OS |
|---|---|
| Molecular Weight | 286.35216 |
| InChIKey | OFUCMXPHVMKRTO-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2nnc3ccc(SC)nn23)cc1 |
| 1,2,4-Triazolo[4,3-b]pyridazine, 3-(4-ethoxyphenyl)-6-(methylthio)- |