4-CHLORO-6-NITRO-M-CRESOL structure
|
Common Name | 4-CHLORO-6-NITRO-M-CRESOL | ||
|---|---|---|---|---|
| CAS Number | 7147-89-9 | Molecular Weight | 187.58000 | |
| Density | N/A | Boiling Point | 276.7ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | 132-134 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 4-chloro-6-nitro-m-cresol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 276.7ºC at 760 mmHg |
|---|---|
| Melting Point | 132-134 °C(lit.) |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58000 |
| Exact Mass | 187.00400 |
| PSA | 66.05000 |
| LogP | 2.78540 |
| InChIKey | JBMGJOKJUYGIJH-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c([N+](=O)[O-])cc1Cl |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2908999090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
A novel approach to predict a toxicological property of aromatic compounds in the Tetrahymena pyriformis.
Bioorg. Med. Chem. 12(4) , 735-44, (2004) The TOPological Substructural MOlecular DEsign (TOPS-MODE) has been successfully used in order to explain the toxicity in the Tetrahymena pyriformis on a large data set. The obtained models for the tr... |
| 4-chloro-5-methyl-2-nitrophenol |
| EINECS 230-461-5 |
| MFCD00007114 |