4-chloro-6-nitro-2-(trifluoromethyl)-1H-benzimidazole
Modify Date: 2025-10-05 18:52:15
4-chloro-6-nitro-2-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 4-chloro-6-nitro-2-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 4228-91-5 | Molecular Weight | 265.57700 | |
| Density | 1.742g/cm3 | Boiling Point | 381.8ºC at 760mmHg | |
| Molecular Formula | C8H3ClF3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | 4-chloro-6-nitro-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.742g/cm3 |
|---|---|
| Boiling Point | 381.8ºC at 760mmHg |
| Molecular Formula | C8H3ClF3N3O2 |
| Molecular Weight | 265.57700 |
| Flash Point | 184.7ºC |
| Exact Mass | 264.98700 |
| PSA | 74.50000 |
| LogP | 3.66650 |
| Index of Refraction | 1.612 |
| InChIKey | HNDQGIJHWSTKDW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c2nc(C(F)(F)F)[nH]c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chlor-6-nitro-2-trifluormethylbenzimidazol |
| 4-chloro-6-nitro-2-trifluoromethylbenzimidazole |