m-hydroxycocaine
Modify Date: 2025-09-10 20:22:58
m-hydroxycocaine structure
|
Common Name | m-hydroxycocaine | ||
|---|---|---|---|---|
| CAS Number | 71387-58-1 | Molecular Weight | 319.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-hydroxy-cocaine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21NO5 |
|---|---|
| Molecular Weight | 319.35200 |
| Exact Mass | 319.14200 |
| PSA | 76.07000 |
| LogP | 1.51120 |
| InChIKey | IQXBUEUAOWARGT-PMOUVXMZSA-N |
| SMILES | COC(=O)C1C(OC(=O)c2cccc(O)c2)CC2CCC1N2C |
| Storage condition | −20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H317-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22-43 |
| Safety Phrases | 22-26-36/37/39 |
| RIDADR | UN 1544 6.1/PG 2 |
| WGK Germany | 3 |
|
Arylhydroxy metabolites of cocaine in the urine of cocaine users.
J. Anal. Toxicol. 8(1) , 35-7, (1984) The major arylhydroxy metabolite of cocaine in human urine was identified as 4'-hydroxybenzoylecgonine methyl ester by comparison of mass spectral and relative gas-liquid chromatography retention time... |
| m-hydroxycocaine |
| (1R)-3exo-(3-hydroxy-benzoyloxy)-tropane-2exo-carboxylic acid methyl ester |
| (1R)-3exo-(3-Hydroxy-benzoyloxy)-tropan-2exo-carbonsaeure-methylester |